C11H15NO2 — CID 83830365
7-methoxy-2-(methylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 83830365) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 7-methoxy-2-(methylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 7-methoxy-2-(methylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 83830365 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 7-methoxy-2-(methylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CNC1Cc2cccc(OC)c2C1O |
| InChI | InChI=1S/C11H15NO2/c1-12-8-6-7-4-3-5-9(14-2)10(7)11(8)13/h3-5,8,11-13H,6H2,1-2H3 |
| InChIKey | JYRHXVRXHFBWGZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |