C11H15NO2 — CID 122504635
5-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 122504635) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 5-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | 5-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 122504635 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 5-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | COc1cccc2c1C(O)CN(C)C2 |
| InChI | InChI=1S/C11H15NO2/c1-12-6-8-4-3-5-10(14-2)11(8)9(13)7-12/h3-5,9,13H,6-7H2,1-2H3 |
| InChIKey | CMQFFLCZKCKTRG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |