About 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol
7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 121000209) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol.
Molecular Properties
| Compound Name | 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol |
| PubChem CID | 121000209 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | COc1ccc2c(c1C)CN(C)CC2O |
| InChI | InChI=1S/C12H17NO2/c1-8-10-6-13(2)7-11(14)9(10)4-5-12(8)15-3/h4-5,11,14H,6-7H2,1-3H3 |
| InChIKey | NMWZMHMUHNQISD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol?
The IUPAC name of 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol (CID 121000209) is 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol.
What is the SMILES notation for 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol?
The canonical SMILES for 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol is COc1ccc2c(c1C)CN(C)CC2O.
What is the InChIKey of 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol?
The InChIKey is NMWZMHMUHNQISD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-8-10-6-13(2)7-11(14)9(10)4-5-12(8)15-3/h4-5,11,14H,6-7H2,1-3H3.
What are the key properties of 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol?
7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol has a molecular weight of 207.27 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-2,8-dimethyl-3,4-dihydro-1H-isoquinolin-4-ol is sourced from PubChem (CID 121000209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).