C11H16N2O2 — CID 82395337
8-amino-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 82395337) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 8-amino-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | 8-amino-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 82395337 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 8-amino-7-methoxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | COc1ccc2c(c1N)CN(C)CC2O |
| InChI | InChI=1S/C11H16N2O2/c1-13-5-8-7(9(14)6-13)3-4-10(15-2)11(8)12/h3-4,9,14H,5-6,12H2,1-2H3 |
| InChIKey | ACVPKCYNTZJVTN-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|