C10H12INO — CID 97455914
(4R)-5-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 97455914) has the molecular formula C10H12INO and a molecular weight of 289.12 g/mol. Its IUPAC name is (4R)-5-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | (4R)-5-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 97455914 |
| Molecular Formula | C10H12INO |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (4R)-5-iodo-2-methyl-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | CN1Cc2cccc(I)c2[C@@H](O)C1 |
| InChI | InChI=1S/C10H12INO/c1-12-5-7-3-2-4-8(11)10(7)9(13)6-12/h2-4,9,13H,5-6H2,1H3/t9-/m0/s1 |
| InChIKey | BXMJYXBROALGEP-VIFPVBQESA-N |
| XLogP | 1.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|