C19H22N2 — CID 10446286
(1R,12R)-3,10-dimethyl-12-phenyl-3,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene (PubChem CID 10446286) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1R,12R)-3,10-dimethyl-12-phenyl-3,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene.
| Compound Name | (1R,12R)-3,10-dimethyl-12-phenyl-3,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
|---|---|
| PubChem CID | 10446286 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (1R,12R)-3,10-dimethyl-12-phenyl-3,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
| SMILES | CN1Cc2cccc3c2[C@H](CN3C)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C19H22N2/c1-20-11-15-9-6-10-18-19(15)17(13-21(18)2)16(12-20)14-7-4-3-5-8-14/h3-10,16-17H,11-13H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | ZFKGXUBXVAMMIF-DLBZAZTESA-N |
| XLogP | 3.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |