C17H19N — CID 71450608
2,5-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 71450608) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 2,5-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2,5-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 71450608 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2,5-dimethyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1cccc2c1C(c1ccccc1)CN(C)C2 |
| InChI | InChI=1S/C17H19N/c1-13-7-6-10-15-11-18(2)12-16(17(13)15)14-8-4-3-5-9-14/h3-10,16H,11-12H2,1-2H3 |
| InChIKey | PUACBDCIAIMRLD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |