C20H21Cl2N — CID 155698291
buta-1,3-diene;5,6-dichloro-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline (PubChem CID 155698291) has the molecular formula C20H21Cl2N and a molecular weight of 346.30 g/mol. Its IUPAC name is buta-1,3-diene;5,6-dichloro-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | buta-1,3-diene;5,6-dichloro-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 155698291 |
| Molecular Formula | C20H21Cl2N |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | buta-1,3-diene;5,6-dichloro-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinoline |
| SMILES | C=CC=C.CN1Cc2ccc(Cl)c(Cl)c2C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15Cl2N.C4H6/c1-19-9-12-7-8-14(17)16(18)15(12)13(10-19)11-5-3-2-4-6-11;1-3-4-2/h2-8,13H,9-10H2,1H3;3-4H,1-2H2 |
| InChIKey | KPYYHEDBNNYAEI-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|