C11H14N2 — CID 163427854
(4R)-1-methyl-4-phenylpyrrolidin-3-imine (PubChem CID 163427854) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is (4R)-1-methyl-4-phenylpyrrolidin-3-imine.
| Compound Name | (4R)-1-methyl-4-phenylpyrrolidin-3-imine |
|---|---|
| PubChem CID | 163427854 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (4R)-1-methyl-4-phenylpyrrolidin-3-imine |
| SMILES | [H]/N=C1\CN(C)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H14N2/c1-13-7-10(11(12)8-13)9-5-3-2-4-6-9/h2-6,10,12H,7-8H2,1H3/b12-11+/t10-/m0/s1 |
| InChIKey | AOBFJABJXSIEPG-IUZMTQGWSA-N |
| XLogP | 1.74 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|