C16H17NO — CID 71497499
(4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-ol (PubChem CID 71497499) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-ol.
| Compound Name | (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-ol |
|---|---|
| PubChem CID | 71497499 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | (4R)-2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-ol |
| SMILES | CN1Cc2c(O)cccc2[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C16H17NO/c1-17-10-14(12-6-3-2-4-7-12)13-8-5-9-16(18)15(13)11-17/h2-9,14,18H,10-11H2,1H3/t14-/m1/s1 |
| InChIKey | AUOGWJKRNSZLMZ-CQSZACIVSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|