C19H21ClN2O2 — CID 3029033
2-chloroethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate (PubChem CID 3029033) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-chloroethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate.
| Compound Name | 2-chloroethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate |
|---|---|
| PubChem CID | 3029033 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-chloroethyl N-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)carbamate |
| SMILES | CN1Cc2c(NC(=O)OCCCl)cccc2C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-22-12-16(14-6-3-2-4-7-14)15-8-5-9-18(17(15)13-22)21-19(23)24-11-10-20/h2-9,16H,10-13H2,1H3,(H,21,23) |
| InChIKey | JBUMIENRXVFESF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|