C26H32ClN3O5 — CID 24832153
(Z)-but-2-enedioic acid;2-(butylamino)-N-[4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]acetamide (PubChem CID 24832153) has the molecular formula C26H32ClN3O5 and a molecular weight of 502.01 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(butylamino)-N-[4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]acetamide.
| Compound Name | (Z)-but-2-enedioic acid;2-(butylamino)-N-[4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]acetamide |
|---|---|
| PubChem CID | 24832153 |
| Molecular Formula | C26H32ClN3O5 |
| Molecular Weight | 502.01 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(butylamino)-N-[4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-isoquinolin-8-yl]acetamide |
| SMILES | CCCCNCC(=O)Nc1cccc2c1CN(C)CC2c1ccc(Cl)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C22H28ClN3O.C4H4O4/c1-3-4-12-24-13-22(27)25-21-7-5-6-18-19(14-26(2)15-20(18)21)16-8-10-17(23)11-9-16;5-3(6)1-2-4(7)8/h5-11,19,24H,3-4,12-15H2,1-2H3,(H,25,27);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | OPFALQCIXQCSEQ-BTJKTKAUSA-N |
| XLogP | 3.96 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.01 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|