C25H31N3O5 — CID 24847489
(Z)-but-2-enedioic acid;1-butyl-3-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)urea (PubChem CID 24847489) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-butyl-3-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)urea.
| Compound Name | (Z)-but-2-enedioic acid;1-butyl-3-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)urea |
|---|---|
| PubChem CID | 24847489 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-butyl-3-(2-methyl-4-phenyl-3,4-dihydro-1H-isoquinolin-8-yl)urea |
| SMILES | CCCCNC(=O)Nc1cccc2c1CN(C)CC2c1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C21H27N3O.C4H4O4/c1-3-4-13-22-21(25)23-20-12-8-11-17-18(14-24(2)15-19(17)20)16-9-6-5-7-10-16;5-3(6)1-2-4(7)8/h5-12,18H,3-4,13-15H2,1-2H3,(H2,22,23,25);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FQLALRSFSMEIGL-BTJKTKAUSA-N |
| XLogP | 3.90 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|