About (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline
(4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline (PubChem CID 11493122) has the molecular formula C18H16ClNO
and a molecular weight of 297.79 g/mol. Its IUPAC name is (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline.
Molecular Properties
| Compound Name | (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline |
| PubChem CID | 11493122 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline |
| SMILES | CN1Cc2c(ccc3occc23)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H16ClNO/c1-20-10-16(12-2-4-13(19)5-3-12)14-6-7-18-15(8-9-21-18)17(14)11-20/h2-9,16H,10-11H2,1H3/t16-/m0/s1 |
| InChIKey | SFFWNTMOSLITBU-INIZCTEOSA-N |
| XLogP | 4.66 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline?
The IUPAC name of (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline (CID 11493122) is (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline.
What is the SMILES notation for (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline?
The canonical SMILES for (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline is CN1Cc2c(ccc3occc23)[C@H](c2ccc(Cl)cc2)C1.
What is the InChIKey of (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline?
The InChIKey is SFFWNTMOSLITBU-INIZCTEOSA-N. The full InChI is InChI=1S/C18H16ClNO/c1-20-10-16(12-2-4-13(19)5-3-12)14-6-7-18-15(8-9-21-18)17(14)11-20/h2-9,16H,10-11H2,1H3/t16-/m0/s1.
What are the key properties of (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline?
(4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline has a molecular weight of 297.79 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(4-chlorophenyl)-2-methyl-3,4-dihydro-1H-furo[2,3-h]isoquinoline is sourced from PubChem (CID 11493122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).