C14H15NO2 — CID 13365160
4-(6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-yl)phenol (PubChem CID 13365160) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-yl)phenol.
| Compound Name | 4-(6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-yl)phenol |
|---|---|
| PubChem CID | 13365160 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4-(6-methyl-5,7-dihydro-4H-furo[2,3-c]pyridin-4-yl)phenol |
| SMILES | CN1Cc2occc2C(c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C14H15NO2/c1-15-8-13(10-2-4-11(16)5-3-10)12-6-7-17-14(12)9-15/h2-7,13,16H,8-9H2,1H3 |
| InChIKey | DKPYQTZMECPXJD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |