C16H18N2O — CID 20531690
3-(8-amino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenol (PubChem CID 20531690) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-(8-amino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenol.
| Compound Name | 3-(8-amino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenol |
|---|---|
| PubChem CID | 20531690 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3-(8-amino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenol |
| SMILES | CN1Cc2c(N)cccc2C(c2cccc(O)c2)C1 |
| InChI | InChI=1S/C16H18N2O/c1-18-9-14(11-4-2-5-12(19)8-11)13-6-3-7-16(17)15(13)10-18/h2-8,14,19H,9-10,17H2,1H3 |
| InChIKey | FCVIVPJROUDKGM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|