C19H24N4O2 — CID 141072082
ethyl N-[3-(6,8-diamino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamate (PubChem CID 141072082) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is ethyl N-[3-(6,8-diamino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamate.
| Compound Name | ethyl N-[3-(6,8-diamino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 141072082 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | ethyl N-[3-(6,8-diamino-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C2CN(C)Cc3c(N)cc(N)cc32)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-3-25-19(24)22-14-6-4-5-12(7-14)16-10-23(2)11-17-15(16)8-13(20)9-18(17)21/h4-9,16H,3,10-11,20-21H2,1-2H3,(H,22,24) |
| InChIKey | CMJICTBGBSCGAJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|