C12H18N2 — CID 96750295
(3R,4R)-1-methyl-3-phenylpiperidin-4-amine (PubChem CID 96750295) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is (3R,4R)-1-methyl-3-phenylpiperidin-4-amine.
| Compound Name | (3R,4R)-1-methyl-3-phenylpiperidin-4-amine |
|---|---|
| PubChem CID | 96750295 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | (3R,4R)-1-methyl-3-phenylpiperidin-4-amine |
| SMILES | CN1CC[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C12H18N2/c1-14-8-7-12(13)11(9-14)10-5-3-2-4-6-10/h2-6,11-12H,7-9,13H2,1H3/t11-,12+/m0/s1 |
| InChIKey | SAZLRTLSQAZLSR-NWDGAFQWSA-N |
| XLogP | 1.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |