C12H17NO2 — CID 117200379
1-(4-methoxy-1-methyl-2,3-dihydroindol-3-yl)ethanol (PubChem CID 117200379) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-(4-methoxy-1-methyl-2,3-dihydroindol-3-yl)ethanol.
| Compound Name | 1-(4-methoxy-1-methyl-2,3-dihydroindol-3-yl)ethanol |
|---|---|
| PubChem CID | 117200379 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 1-(4-methoxy-1-methyl-2,3-dihydroindol-3-yl)ethanol |
| SMILES | COc1cccc2c1C(C(C)O)CN2C |
| InChI | InChI=1S/C12H17NO2/c1-8(14)9-7-13(2)10-5-4-6-11(15-3)12(9)10/h4-6,8-9,14H,7H2,1-3H3 |
| InChIKey | PDUDRHFNXWBEBT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |