C12H12O — CID 174387998
1,2,3,3a-tetrahydroacenaphthylen-3-ol (PubChem CID 174387998) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1,2,3,3a-tetrahydroacenaphthylen-3-ol.
| Compound Name | 1,2,3,3a-tetrahydroacenaphthylen-3-ol |
|---|---|
| PubChem CID | 174387998 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1,2,3,3a-tetrahydroacenaphthylen-3-ol |
| SMILES | OC1C=Cc2cccc3c2C1CC3 |
| InChI | InChI=1S/C12H12O/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-3,5,7,10-11,13H,4,6H2 |
| InChIKey | FZDMOAZBOCGLJK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |