C10H13NO — CID 129390412
(3S)-3-(methylamino)-2,3-dihydro-1H-inden-4-ol (PubChem CID 129390412) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is (3S)-3-(methylamino)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | (3S)-3-(methylamino)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 129390412 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (3S)-3-(methylamino)-2,3-dihydro-1H-inden-4-ol |
| SMILES | CN[C@H]1CCc2cccc(O)c21 |
| InChI | InChI=1S/C10H13NO/c1-11-8-6-5-7-3-2-4-9(12)10(7)8/h2-4,8,11-12H,5-6H2,1H3/t8-/m0/s1 |
| InChIKey | IQKACIYAXCLCEN-QMMMGPOBSA-N |
| XLogP | 1.60 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|