C19H22O — CID 140664493
7-(4-tert-butylphenyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 140664493) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 7-(4-tert-butylphenyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 7-(4-tert-butylphenyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 140664493 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 7-(4-tert-butylphenyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC(C)(C)c1ccc(-c2cccc3c2C(O)CC3)cc1 |
| InChI | InChI=1S/C19H22O/c1-19(2,3)15-10-7-13(8-11-15)16-6-4-5-14-9-12-17(20)18(14)16/h4-8,10-11,17,20H,9,12H2,1-3H3 |
| InChIKey | BGEUMPHVVJKWCS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |