C15H19NO — CID 10059714
(2aR,8bR)-8-methoxy-2-prop-2-enyl-2a,3,4,8b-tetrahydro-1H-naphtho[2,1-b]azete (PubChem CID 10059714) has the molecular formula C15H19NO and a molecular weight of 229.32 g/mol. Its IUPAC name is (2aR,8bR)-8-methoxy-2-prop-2-enyl-2a,3,4,8b-tetrahydro-1H-naphtho[2,1-b]azete.
| Compound Name | (2aR,8bR)-8-methoxy-2-prop-2-enyl-2a,3,4,8b-tetrahydro-1H-naphtho[2,1-b]azete |
|---|---|
| PubChem CID | 10059714 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | (2aR,8bR)-8-methoxy-2-prop-2-enyl-2a,3,4,8b-tetrahydro-1H-naphtho[2,1-b]azete |
| SMILES | C=CCN1C[C@H]2c3c(cccc3OC)CC[C@H]21 |
| InChI | InChI=1S/C15H19NO/c1-3-9-16-10-12-13(16)8-7-11-5-4-6-14(17-2)15(11)12/h3-6,12-13H,1,7-10H2,2H3/t12-,13-/m1/s1 |
| InChIKey | FLYJXYQYBLPWIJ-CHWSQXEVSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|