C13H18N2S — CID 57315189
5-prop-2-enyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline (PubChem CID 57315189) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 5-prop-2-enyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline.
| Compound Name | 5-prop-2-enyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline |
|---|---|
| PubChem CID | 57315189 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 5-prop-2-enyl-4a,6,7,8,8a,9-hexahydro-4H-[1,3]thiazolo[4,5-g]quinoline |
| SMILES | C=CCN1CCCC2Cc3ncsc3CC21 |
| InChI | InChI=1S/C13H18N2S/c1-2-5-15-6-3-4-10-7-11-13(8-12(10)15)16-9-14-11/h2,9-10,12H,1,3-8H2 |
| InChIKey | DVABTJUHLPKYDL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|