C13H18N2O2S2 — CID 97386426
(3aR,6aS)-1-prop-2-enyl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 97386426) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (3aR,6aS)-1-prop-2-enyl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aR,6aS)-1-prop-2-enyl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97386426 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (3aR,6aS)-1-prop-2-enyl-4-thiophen-2-ylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | C=CCN1CC[C@@H]2[C@@H]1CCN2S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-2-7-14-8-5-12-11(14)6-9-15(12)19(16,17)13-4-3-10-18-13/h2-4,10-12H,1,5-9H2/t11-,12+/m0/s1 |
| InChIKey | IURRDZOLYUSQOC-NWDGAFQWSA-N |
| XLogP | 1.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|