C18H23F3N2O4S — CID 155846831
(3aR,6aS)-4-benzylsulfonyl-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155846831) has the molecular formula C18H23F3N2O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is (3aR,6aS)-4-benzylsulfonyl-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,6aS)-4-benzylsulfonyl-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155846831 |
| Molecular Formula | C18H23F3N2O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (3aR,6aS)-4-benzylsulfonyl-1-prop-2-enyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCN1CC[C@@H]2[C@@H]1CCN2S(=O)(=O)Cc1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N2O2S.C2HF3O2/c1-2-10-17-11-8-16-15(17)9-12-18(16)21(19,20)13-14-6-4-3-5-7-14;3-2(4,5)1(6)7/h2-7,15-16H,1,8-13H2;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | JXOSAEGKRXZDFW-IDVLALEDSA-N |
| XLogP | 2.48 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|