C11H10BrF4NO2S — CID 177395353
1-benzylsulfonyl-2-(2-bromo-1,1,2,2-tetrafluoroethyl)aziridine (PubChem CID 177395353) has the molecular formula C11H10BrF4NO2S and a molecular weight of 376.17 g/mol. Its IUPAC name is 1-benzylsulfonyl-2-(2-bromo-1,1,2,2-tetrafluoroethyl)aziridine.
| Compound Name | 1-benzylsulfonyl-2-(2-bromo-1,1,2,2-tetrafluoroethyl)aziridine |
|---|---|
| PubChem CID | 177395353 |
| Molecular Formula | C11H10BrF4NO2S |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | 1-benzylsulfonyl-2-(2-bromo-1,1,2,2-tetrafluoroethyl)aziridine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CC1C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C11H10BrF4NO2S/c12-11(15,16)10(13,14)9-6-17(9)20(18,19)7-8-4-2-1-3-5-8/h1-5,9H,6-7H2 |
| InChIKey | NALANZPIORUVMV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|