C16H25NO2S — CID 59852632
1-benzylsulfonyl-2-(2-methylbutan-2-yl)pyrrolidine (PubChem CID 59852632) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 1-benzylsulfonyl-2-(2-methylbutan-2-yl)pyrrolidine.
| Compound Name | 1-benzylsulfonyl-2-(2-methylbutan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 59852632 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1-benzylsulfonyl-2-(2-methylbutan-2-yl)pyrrolidine |
| SMILES | CCC(C)(C)C1CCCN1S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H25NO2S/c1-4-16(2,3)15-11-8-12-17(15)20(18,19)13-14-9-6-5-7-10-14/h5-7,9-10,15H,4,8,11-13H2,1-3H3 |
| InChIKey | KJQMLDXTKAYFBI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |