C20H26N4O3S — CID 162631357
1-[(3aS,6aS)-4-benzylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-(2-methylpyrazol-3-yl)propan-1-one (PubChem CID 162631357) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-[(3aS,6aS)-4-benzylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-(2-methylpyrazol-3-yl)propan-1-one.
| Compound Name | 1-[(3aS,6aS)-4-benzylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-(2-methylpyrazol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 162631357 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[(3aS,6aS)-4-benzylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-3-(2-methylpyrazol-3-yl)propan-1-one |
| SMILES | Cn1nccc1CCC(=O)N1CC[C@H]2[C@@H]1CCN2S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-22-17(9-12-21-22)7-8-20(25)23-13-10-19-18(23)11-14-24(19)28(26,27)15-16-5-3-2-4-6-16/h2-6,9,12,18-19H,7-8,10-11,13-15H2,1H3/t18-,19-/m0/s1 |
| InChIKey | UZIIAQRMEYONLF-OALUTQOASA-N |
| XLogP | 1.56 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |