C15H20N2O3S — CID 97459058
1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-phenylethanone (PubChem CID 97459058) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-phenylethanone.
| Compound Name | 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-phenylethanone |
|---|---|
| PubChem CID | 97459058 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-phenylethanone |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H]1CCN2C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C15H20N2O3S/c1-21(19,20)17-10-8-13-14(17)7-9-16(13)15(18)11-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | VQFZBMCNFLLAIM-KGLIPLIRSA-N |
| XLogP | 0.86 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |