C16H19F4N3O5S — CID 155869389
1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155869389) has the molecular formula C16H19F4N3O5S and a molecular weight of 441.40 g/mol. Its IUPAC name is 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155869389 |
| Molecular Formula | C16H19F4N3O5S |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 1-[(3aS,6aR)-4-methylsulfonyl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]-2-(5-fluoro-2-pyridinyl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)N1CC[C@@H]2[C@@H]1CCN2C(=O)Cc1ccc(F)cn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H18FN3O3S.C2HF3O2/c1-22(20,21)18-7-5-12-13(18)4-6-17(12)14(19)8-11-3-2-10(15)9-16-11;3-2(4,5)1(6)7/h2-3,9,12-13H,4-8H2,1H3;(H,6,7)/t12-,13+;/m1./s1 |
| InChIKey | KXKAXSYWXGHHDQ-KZCZEQIWSA-N |
| XLogP | 1.03 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |