C20H24F4N2O3 — CID 155828290
1-[(3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155828290) has the molecular formula C20H24F4N2O3 and a molecular weight of 416.42 g/mol. Its IUPAC name is 1-[(3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828290 |
| Molecular Formula | C20H24F4N2O3 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[(3aR,6aS)-1-(cyclopropylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1ccc(F)cc1)N1CC[C@H]2[C@H]1CCN2CC1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23FN2O.C2HF3O2/c19-15-5-3-13(4-6-15)11-18(22)21-10-8-16-17(21)7-9-20(16)12-14-1-2-14;3-2(4,5)1(6)7/h3-6,14,16-17H,1-2,7-12H2;(H,6,7)/t16-,17+;/m0./s1 |
| InChIKey | FCKFTHUQLPBUJQ-MCJVGQIASA-N |
| XLogP | 3.09 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |