C20H27F3N2O4S — CID 155835276
1-[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155835276) has the molecular formula C20H27F3N2O4S and a molecular weight of 448.51 g/mol. Its IUPAC name is 1-[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155835276 |
| Molecular Formula | C20H27F3N2O4S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 1-[1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1cccs1)N1CCC2C1CCN2CC1CCOCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H26N2O2S.C2HF3O2/c21-18(12-15-2-1-11-23-15)20-8-4-16-17(20)3-7-19(16)13-14-5-9-22-10-6-14;3-2(4,5)1(6)7/h1-2,11,14,16-17H,3-10,12-13H2;(H,6,7) |
| InChIKey | SHVQFVIESZRELZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |