C21H27F3N2O4 — CID 155824953
(3aR,7aR)-1-(oxan-4-ylmethyl)-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155824953) has the molecular formula C21H27F3N2O4 and a molecular weight of 428.45 g/mol. Its IUPAC name is (3aR,7aR)-1-(oxan-4-ylmethyl)-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-1-(oxan-4-ylmethyl)-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155824953 |
| Molecular Formula | C21H27F3N2O4 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | (3aR,7aR)-1-(oxan-4-ylmethyl)-4-phenyl-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CC[C@@H]2[C@@H](CCN2CC2CCOCC2)N1c1ccccc1 |
| InChI | InChI=1S/C19H26N2O2.C2HF3O2/c22-19-7-6-17-18(21(19)16-4-2-1-3-5-16)8-11-20(17)14-15-9-12-23-13-10-15;3-2(4,5)1(6)7/h1-5,15,17-18H,6-14H2;(H,6,7)/t17-,18-;/m1./s1 |
| InChIKey | AMCXBQZMRVQAOA-JAXOOIEVSA-N |
| XLogP | 3.32 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |