C15H23F3N2O4 — CID 155841420
(3aR,7aS)-1-(oxan-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155841420) has the molecular formula C15H23F3N2O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is (3aR,7aS)-1-(oxan-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aS)-1-(oxan-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841420 |
| Molecular Formula | C15H23F3N2O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (3aR,7aS)-1-(oxan-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CC[C@H]2[C@@H](CCN2CC2CCOCC2)N1 |
| InChI | InChI=1S/C13H22N2O2.C2HF3O2/c16-13-2-1-12-11(14-13)3-6-15(12)9-10-4-7-17-8-5-10;3-2(4,5)1(6)7/h10-12H,1-9H2,(H,14,16);(H,6,7)/t11-,12+;/m1./s1 |
| InChIKey | OJXZOYQQXDZTNT-LYCTWNKOSA-N |
| XLogP | 1.40 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |