C22H31F3N2O5 — CID 155825964
(3aS,7aS)-1-[(5-ethylfuran-2-yl)methyl]-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155825964) has the molecular formula C22H31F3N2O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is (3aS,7aS)-1-[(5-ethylfuran-2-yl)methyl]-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aS,7aS)-1-[(5-ethylfuran-2-yl)methyl]-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155825964 |
| Molecular Formula | C22H31F3N2O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (3aS,7aS)-1-[(5-ethylfuran-2-yl)methyl]-4-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | CCc1ccc(CN2CC[C@H]3[C@@H]2CCC(=O)N3CC2CCOCC2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H30N2O3.C2HF3O2/c1-2-16-3-4-17(25-16)14-21-10-7-19-18(21)5-6-20(23)22(19)13-15-8-11-24-12-9-15;3-2(4,5)1(6)7/h3-4,15,18-19H,2,5-14H2,1H3;(H,6,7)/t18-,19-;/m0./s1 |
| InChIKey | YKRSTRHSQIVRCE-HLRBRJAUSA-N |
| XLogP | 3.47 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |