C21H33F6N3O6 — CID 155824942
(3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824942) has the molecular formula C21H33F6N3O6 and a molecular weight of 537.50 g/mol. Its IUPAC name is (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824942 |
| Molecular Formula | C21H33F6N3O6 |
| Molecular Weight | 537.50 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(oxan-4-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN1C(=O)CC[C@@H]2[C@H]1CCN2CC1CCOCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H31N3O2.2C2HF3O2/c1-18(2)9-10-20-16-5-8-19(15(16)3-4-17(20)21)13-14-6-11-22-12-7-14;2*3-2(4,5)1(6)7/h14-16H,3-13H2,1-2H3;2*(H,6,7)/t15-,16-;;/m1../s1 |
| InChIKey | IZIMIOCUUKNPCP-UWGSCQAASA-N |
| XLogP | 2.31 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |