C20H27F6N3O6 — CID 155824944
(3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(furan-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155824944) has the molecular formula C20H27F6N3O6 and a molecular weight of 519.44 g/mol. Its IUPAC name is (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(furan-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(furan-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155824944 |
| Molecular Formula | C20H27F6N3O6 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(furan-2-ylmethyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN1C(=O)CC[C@@H]2[C@H]1CCN2Cc1ccco1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O2.2C2HF3O2/c1-17(2)9-10-19-15-7-8-18(12-13-4-3-11-21-13)14(15)5-6-16(19)20;2*3-2(4,5)1(6)7/h3-4,11,14-15H,5-10,12H2,1-2H3;2*(H,6,7)/t14-,15-;;/m1../s1 |
| InChIKey | UEFRODQDZQRDCM-FXUMYAARSA-N |
| XLogP | 2.67 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |