C21H27F4N3O4 — CID 155848464
(3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155848464) has the molecular formula C21H27F4N3O4 and a molecular weight of 461.46 g/mol. Its IUPAC name is (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848464 |
| Molecular Formula | C21H27F4N3O4 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-[2-(4-fluorophenyl)acetyl]-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCN1C(=O)CC[C@@H]2[C@H]1CCN2C(=O)Cc1ccc(F)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26FN3O2.C2HF3O2/c1-21(2)11-12-23-17-9-10-22(16(17)7-8-18(23)24)19(25)13-14-3-5-15(20)6-4-14;3-2(4,5)1(6)7/h3-6,16-17H,7-13H2,1-2H3;(H,6,7)/t16-,17-;/m1./s1 |
| InChIKey | OTDZXQPIWDDONA-GBNZRNLASA-N |
| XLogP | 2.15 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |