C18H19FN4O — CID 125235696
1-[(3aS,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 125235696) has the molecular formula C18H19FN4O and a molecular weight of 326.37 g/mol. Its IUPAC name is 1-[(3aS,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[(3aS,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 125235696 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[(3aS,6aS)-1-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CC[C@H]2[C@@H]1CCN2c1ncccn1 |
| InChI | InChI=1S/C18H19FN4O/c19-14-4-2-13(3-5-14)12-17(24)22-10-6-16-15(22)7-11-23(16)18-20-8-1-9-21-18/h1-5,8-9,15-16H,6-7,10-12H2/t15-,16-/m0/s1 |
| InChIKey | TZPRLNOUDXMABC-HOTGVXAUSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |