C18H24F3N3O4S — CID 155842112
(3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(thiophene-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155842112) has the molecular formula C18H24F3N3O4S and a molecular weight of 435.47 g/mol. Its IUPAC name is (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(thiophene-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(thiophene-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155842112 |
| Molecular Formula | C18H24F3N3O4S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | (3aR,7aR)-4-[2-(dimethylamino)ethyl]-1-(thiophene-2-carbonyl)-2,3,3a,6,7,7a-hexahydropyrrolo[3,2-b]pyridin-5-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCN1C(=O)CC[C@@H]2[C@H]1CCN2C(=O)c1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23N3O2S.C2HF3O2/c1-17(2)9-10-18-13-7-8-19(12(13)5-6-15(18)20)16(21)14-4-3-11-22-14;3-2(4,5)1(6)7/h3-4,11-13H,5-10H2,1-2H3;(H,6,7)/t12-,13-;/m1./s1 |
| InChIKey | IIQWVPIVPDRWPW-OJERSXHUSA-N |
| XLogP | 2.15 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |