C20H24F3N3O4S — CID 118743253
1-[2-(dimethylamino)ethyl]-7-(thiophene-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 118743253) has the molecular formula C20H24F3N3O4S and a molecular weight of 459.49 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-7-(thiophene-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[2-(dimethylamino)ethyl]-7-(thiophene-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743253 |
| Molecular Formula | C20H24F3N3O4S |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-7-(thiophene-2-carbonyl)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCn1c2c(ccc1=O)CCN(C(=O)c1cccs1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N3O2S.C2HF3O2/c1-19(2)11-12-21-15-8-10-20(18(23)16-4-3-13-24-16)9-7-14(15)5-6-17(21)22;3-2(4,5)1(6)7/h3-6,13H,7-12H2,1-2H3;(H,6,7) |
| InChIKey | XMCSIRPSCVXJRY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |