C19H26F3N3O5 — CID 155823418
[(3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155823418) has the molecular formula C19H26F3N3O5 and a molecular weight of 433.43 g/mol. Its IUPAC name is [(3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155823418 |
| Molecular Formula | C19H26F3N3O5 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | [(3aR,6aS)-1-[(5-methylfuran-2-yl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-4-yl]-morpholin-4-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CC[C@@H]3[C@@H]2CCN3C(=O)N2CCOCC2)o1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3.C2HF3O2/c1-13-2-3-14(23-13)12-19-6-4-16-15(19)5-7-20(16)17(21)18-8-10-22-11-9-18;3-2(4,5)1(6)7/h2-3,15-16H,4-12H2,1H3;(H,6,7)/t15-,16+;/m0./s1 |
| InChIKey | XKCPCNYVZRAYPI-IDVLALEDSA-N |
| XLogP | 2.32 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |