C19H27F3N2O6S2 — CID 155832937
(4aS,9aR)-7-[(2-methylphenyl)methyl]-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid (PubChem CID 155832937) has the molecular formula C19H27F3N2O6S2 and a molecular weight of 500.56 g/mol. Its IUPAC name is (4aS,9aR)-7-[(2-methylphenyl)methyl]-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid.
| Compound Name | (4aS,9aR)-7-[(2-methylphenyl)methyl]-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832937 |
| Molecular Formula | C19H27F3N2O6S2 |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (4aS,9aR)-7-[(2-methylphenyl)methyl]-4-methylsulfonyl-2,3,4a,5,6,8,9,9a-octahydro-[1,4]thiazino[2,3-d]azepine 1,1-dioxide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccccc1CN1CC[C@@H]2[C@H](CC1)N(S(C)(=O)=O)CCS2(=O)=O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2O4S2.C2HF3O2/c1-14-5-3-4-6-15(14)13-18-9-7-16-17(8-10-18)25(22,23)12-11-19(16)24(2,20)21;3-2(4,5)1(6)7/h3-6,16-17H,7-13H2,1-2H3;(H,6,7)/t16-,17+;/m0./s1 |
| InChIKey | SCWIEWBXNFPTPV-MCJVGQIASA-N |
| XLogP | 1.65 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |