C16H24N2O3S — CID 71900679
4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 71900679) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 71900679 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[4-[(2-methylphenyl)methyl]piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | Cc1ccccc1CN1CCN(C2CS(=O)(=O)CC2O)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-13-4-2-3-5-14(13)10-17-6-8-18(9-7-17)15-11-22(20,21)12-16(15)19/h2-5,15-16,19H,6-12H2,1H3 |
| InChIKey | WVOCCNFSZVPIKU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |