C13H16N2O3S — CID 131652548
1-benzylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one (PubChem CID 131652548) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-benzylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one.
| Compound Name | 1-benzylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
|---|---|
| PubChem CID | 131652548 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 1-benzylsulfonyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,2-b]pyrrol-5-one |
| SMILES | O=C1CC2C(CCN2S(=O)(=O)Cc2ccccc2)N1 |
| InChI | InChI=1S/C13H16N2O3S/c16-13-8-12-11(14-13)6-7-15(12)19(17,18)9-10-4-2-1-3-5-10/h1-5,11-12H,6-9H2,(H,14,16) |
| InChIKey | COBQPTUZQUVLEJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |