C19H28N4O — CID 171906519
(3aS,6aS)-5-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one (PubChem CID 171906519) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (3aS,6aS)-5-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one.
| Compound Name | (3aS,6aS)-5-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
|---|---|
| PubChem CID | 171906519 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (3aS,6aS)-5-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-2-one |
| SMILES | O=C1C[C@H]2CN(CCN3CCN(Cc4ccccc4)CC3)C[C@H]2N1 |
| InChI | InChI=1S/C19H28N4O/c24-19-12-17-14-23(15-18(17)20-19)11-8-21-6-9-22(10-7-21)13-16-4-2-1-3-5-16/h1-5,17-18H,6-15H2,(H,20,24)/t17-,18+/m0/s1 |
| InChIKey | RRKPVJLEIVMOJJ-ZWKOTPCHSA-N |
| XLogP | 0.62 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |