C15H20N2O — CID 170698594
(3aS,7aR)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 170698594) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (3aS,7aR)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | (3aS,7aR)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 170698594 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (3aS,7aR)-5-benzyl-1-methyl-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | CN1C(=O)C[C@H]2CN(Cc3ccccc3)CC[C@H]21 |
| InChI | InChI=1S/C15H20N2O/c1-16-14-7-8-17(11-13(14)9-15(16)18)10-12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3/t13-,14+/m0/s1 |
| InChIKey | MLBNHMCKLJNHAA-UONOGXRCSA-N |
| XLogP | 1.74 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |