C24H28N2O3 — CID 52936968
(3aS,7aS)-5-benzyl-1-[(2S)-2-phenylmethoxypropanoyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 52936968) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (3aS,7aS)-5-benzyl-1-[(2S)-2-phenylmethoxypropanoyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one.
| Compound Name | (3aS,7aS)-5-benzyl-1-[(2S)-2-phenylmethoxypropanoyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 52936968 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (3aS,7aS)-5-benzyl-1-[(2S)-2-phenylmethoxypropanoyl]-3,3a,4,6,7,7a-hexahydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | C[C@H](OCc1ccccc1)C(=O)N1C(=O)C[C@H]2CN(Cc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C24H28N2O3/c1-18(29-17-20-10-6-3-7-11-20)24(28)26-22-12-13-25(16-21(22)14-23(26)27)15-19-8-4-2-5-9-19/h2-11,18,21-22H,12-17H2,1H3/t18-,21-,22-/m0/s1 |
| InChIKey | LSFSBDHYQKBDSG-NYVOZVTQSA-N |
| XLogP | 3.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |