C23H28N2O2 — CID 26742684
(4aS,9aR)-2-[(4-methoxyphenyl)methyl]-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one (PubChem CID 26742684) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (4aS,9aR)-2-[(4-methoxyphenyl)methyl]-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one.
| Compound Name | (4aS,9aR)-2-[(4-methoxyphenyl)methyl]-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
|---|---|
| PubChem CID | 26742684 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (4aS,9aR)-2-[(4-methoxyphenyl)methyl]-7-phenyl-1,3,4,4a,5,8,9,9a-octahydropyrido[3,4-d]azepin-6-one |
| SMILES | COc1ccc(CN2CC[C@H]3CC(=O)N(c4ccccc4)CC[C@H]3C2)cc1 |
| InChI | InChI=1S/C23H28N2O2/c1-27-22-9-7-18(8-10-22)16-24-13-11-19-15-23(26)25(14-12-20(19)17-24)21-5-3-2-4-6-21/h2-10,19-20H,11-17H2,1H3/t19-,20-/m0/s1 |
| InChIKey | OWBICFVPJZVFGB-PMACEKPBSA-N |
| XLogP | 3.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |